ChemNet > CAS > 499770-79-5 1-Benzofuran-5-yl isocyanate
499770-79-5 1-Benzofuran-5-yl isocyanate
| Nama produk |
1-Benzofuran-5-yl isocyanate |
| Sinonim |
5-isocyanato-1-benzofuran |
| MF |
C9H5NO2 |
| Berat Molekul |
159.1415 |
| InChI |
InChI=1/C9H5NO2/c11-6-10-8-1-2-9-7(5-8)3-4-12-9/h1-5H |
| CAS NO |
499770-79-5 |
| Struktur Molekul |
|
| Kepadatan |
1.23g/cm3 |
| Titik lebur |
36.4℃ |
| Titik didih |
231.2°C at 760 mmHg |
| Indeks bias |
1.602 |
| Titik nyala |
93.6°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
